CAS 801312-28-7

GSK-256066

Description:

GSK-256066, with the CAS number 801312-28-7, is a chemical compound that has been investigated primarily for its potential therapeutic applications, particularly in the field of neuroscience. It is classified as a selective antagonist of the metabotropic glutamate receptor subtype 2 (mGluR2), which plays a crucial role in modulating neurotransmission and synaptic plasticity. The compound's mechanism of action involves inhibiting the activity of mGluR2, which may have implications for treating various neurological disorders, including anxiety and schizophrenia. GSK-256066 is characterized by its specific binding affinity to the target receptor, which is essential for its pharmacological effects. Additionally, its chemical structure includes functional groups that contribute to its solubility and bioavailability. Research on GSK-256066 has focused on its efficacy, safety profile, and potential side effects, making it a subject of interest in drug development and neuropharmacology. As with any investigational compound, further studies are necessary to fully understand its therapeutic potential and mechanisms of action.

Formula: C₂₇H₂₆N₄O₅S

InChI: InChI=1S/C27H26N4O5S/c1-16-11-21(37(34,35)20-10-5-7-17(12-20)27(33)31(2)3)14-22-24(16)29-15-23(26(28)32)25(22)30-18-8-6-9-19(13-18)36-4/h5-15H,1-4H3,(H2,28,32)(H,29,30)

SMILES: Cc1cc(cc2c1[nH]cc(c2=Nc1cccc(c1)OC)C(=N)O)S(=O)(=O)c1cccc(c1)C(=O)N(C)C

Synonyms:

• 6-[[3-[(Dimethylamino)carbonyl]phenyl]sulfonyl]-4-[(3-methoxyphenyl)amino]-8-methyl-3-quinolinecarboxamide
• 6-{[3-(Dimethylcarbamoyl)phenyl]sulfonyl}-4-[(3-methoxyphenyl)amino]-8-methyl-3-quinolinecarboxamide

6-[[3-[(Dimethylamino)carbonyl]phenyl]sulfonyl]-4-[(3-methoxyphenyl)amino]-8-methyl-3-quinolinecarboxamide

CAS: 801312-28-7

Formula: C₂₇H₂₆N₄O₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 518.5841

Ref: IN-DA00G3OG

GSK256066

CAS: 801312-28-7

GSK256066

Purity: ≥98%

Molecular weight: 518.58g/mol

Ref: 54-BUP12686

GSK256066

CAS: 801312-28-7

GSK256066 is a selective PDE4B(equal affinity to isoforms A-D) inhibitor with IC50 of 3.2 pM, >380, 000-fold selectivity versus PDE1/2/3/5/6 and >2500-fold

Formula: C₂₇H₂₆N₄O₅S

Purity: 99.60% - 99.66%

Color and Shape: Solid

Molecular weight: 518.58

Ref: TM-T6054