CAS 801316-08-5

Benzonitrile, 5-amino-2-fluoro-, hydrochloride (1:1)

Description:

Benzonitrile, 5-amino-2-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzonitrile moiety with an amino group and a fluorine atom at specific positions on the aromatic ring. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. The presence of the amino group suggests potential basicity, while the fluorine atom may impart unique electronic properties, influencing reactivity and interaction with biological systems. This compound may be utilized in various applications, including pharmaceuticals and organic synthesis, due to its functional groups that can participate in further chemical reactions. Additionally, its molecular structure may allow for specific interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.

Formula: C₇H₅FN₂·ClH

InChI: InChI=1S/C7H5FN2.ClH/c8-7-2-1-6(10)3-5(7)4-9;/h1-3H,10H2;1H

InChI key: InChIKey=DBYVGRUXKQPZCN-UHFFFAOYSA-N

SMILES: C(#N)C1=C(F)C=CC(N)=C1.Cl

Synonyms:

• Benzonitrile, 5-amino-2-fluoro-, hydrochloride (1:1)
• Benzonitrile, 5-amino-2-fluoro-, monohydrochloride
• 3-Cyano-4-fluoroaniline hydrochloride