CAS 80139-80-6

4-Phenyl-4-piperidinecarboxamide

Description:

4-Phenyl-4-piperidinecarboxamide, identified by its CAS number 80139-80-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenyl group attached to the piperidine nitrogen, along with a carboxamide functional group, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used, often being more soluble in organic solvents than in water. The presence of the piperidine and phenyl groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures have been investigated for their effects on the central nervous system. Additionally, the carboxamide group can participate in hydrogen bonding, influencing the compound's interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₂H₁₆N₂O

InChI: InChI=1S/C12H16N2O/c13-11(15)12(6-8-14-9-7-12)10-4-2-1-3-5-10/h1-5,14H,6-9H2,(H2,13,15)

InChI key: InChIKey=JPUKONSIEHCAQA-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(CCNCC1)C2=CC=CC=C2

Synonyms:

• 4-Piperidinecarboxamide, 4-phenyl-
• 4-Phenyl-4-piperidinecarboxamide
• 4-Phenylpiperidine-4-carboxamide
• Isonipecotamide, 4-phenyl-