CAS 80141-91-9
:(4-fluoro-2-methylphenyl)methanol
Description:
(4-Fluoro-2-methylphenyl)methanol, with the CAS number 80141-91-9, is an organic compound characterized by the presence of a fluorine atom and a methyl group attached to a phenyl ring, along with a hydroxymethyl group. This compound typically exhibits a white to off-white crystalline solid form and is soluble in organic solvents, such as ethanol and acetone, while having limited solubility in water due to its hydrophobic aromatic structure. The presence of the fluorine atom can influence its reactivity and polarity, making it a useful intermediate in organic synthesis and pharmaceuticals. The hydroxymethyl group contributes to its potential as a building block for further chemical modifications. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment to mitigate any potential health risks.
Formula:C8H9FO
InChI:InChI=1/C8H9FO/c1-6-4-8(9)3-2-7(6)5-10/h2-4,10H,5H2,1H3
SMILES:Cc1cc(ccc1CO)F
Synonyms:- 4-Fluoro-2-methylbenzenemethanol
- 4-Fluoro-2-methylbenzyl alcohol
- Q1R Df B1
- Q1R Df B1 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Fluoro-2-methylbenzyl alcohol, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H9FOPurity:99%Color and Shape:White to pale cream, Crystals or crystalline powderMolecular weight:140.164-Fluoro-2-methylbenzyl alcohol
CAS:Formula:C8H9FOPurity:97%Color and Shape:SolidMolecular weight:140.15494-Fluoro-2-methylbenzyl alcohol
CAS:4-Fluoro-2-methylbenzyl alcoholFormula:C8H9FOPurity:97%Color and Shape: faint brown crystalline needlesMolecular weight:140.15g/mol



