CAS 80142-03-6

Ethyl 4-(2-fluorophenyl)-4-piperidinecarboxylate

Description:

Ethyl 4-(2-fluorophenyl)-4-piperidinecarboxylate, identified by its CAS number 80142-03-6, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 2-fluorophenyl substituent indicates that there is a fluorine atom attached to a phenyl ring, which can influence the compound's electronic properties and biological activity. Ethyl 4-(2-fluorophenyl)-4-piperidinecarboxylate is typically a white to off-white solid, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's characteristics, including its melting point, boiling point, and solubility, can vary based on purity and environmental conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.

Formula: C₁₄H₁₈FNO₂

InChI: InChI=1S/C14H18FNO2/c1-2-18-13(17)14(7-9-16-10-8-14)11-5-3-4-6-12(11)15/h3-6,16H,2,7-10H2,1H3

InChI key: InChIKey=RVZZSPDCBKQJPE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(CCNCC1)C2=C(F)C=CC=C2

Synonyms:

• Ethyl 4-(2-fluorophenyl)-4-piperidinecarboxylate
• 4-Piperidinecarboxylic acid, 4-(2-fluorophenyl)-, ethyl ester