CAS 80143-73-3

4-Fluoro-N-(4-fluorophenyl)benzenemethanamine

Description:

4-Fluoro-N-(4-fluorophenyl)benzenemethanamine, identified by its CAS number 80143-73-3, is an organic compound characterized by the presence of both fluorine atoms and an amine functional group. This compound features a benzenemethanamine backbone, where a fluorine atom is substituted at the para position of both the phenyl groups. The presence of these fluorine substituents can influence the compound's physical and chemical properties, such as its polarity, reactivity, and potential biological activity. Typically, compounds with fluorine substitutions exhibit enhanced lipophilicity and may interact differently with biological systems compared to their non-fluorinated counterparts. The amine group suggests potential for hydrogen bonding, which can affect solubility and interaction with other molecules. This compound may be of interest in medicinal chemistry and materials science due to its unique structural features, which could lead to specific pharmacological effects or applications in the development of new materials. However, detailed studies would be necessary to fully understand its properties and potential uses.

Formula: C₁₃H₁₁F₂N

InChI: InChI=1S/C13H11F2N/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-8,16H,9H2

InChI key: InChIKey=OQVIJNAAQBTAAY-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(F)C=C1)C2=CC=C(F)C=C2

Synonyms:

• (4-Fluorobenzyl)(4-fluorophenyl)amine
• 4-Fluoro-N-(4-fluorophenyl)benzenemethanamine
• 4-Fluoro-N-(4-fluorobenzyl)aniline
• Benzenemethanamine, 4-fluoro-N-(4-fluorophenyl)-