
CAS 80155-82-4
:N,N-Bis(2-hydrazinyl-2-oxoethyl)glycine hydrazide
Description:
N,N-Bis(2-hydrazinyl-2-oxoethyl)glycine hydrazide, identified by its CAS number 80155-82-4, is a chemical compound characterized by its hydrazine functional groups and glycine backbone. This substance typically exhibits properties associated with hydrazines, such as being a potential reducing agent and having applications in various fields, including pharmaceuticals and agrochemicals. The presence of multiple hydrazine moieties suggests that it may participate in redox reactions and could serve as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, which could be explored for therapeutic applications. Its solubility and stability in different solvents can vary, influencing its reactivity and potential uses. As with many hydrazine derivatives, safety precautions are essential due to the potential toxicity and reactivity of hydrazines. Overall, N,N-Bis(2-hydrazinyl-2-oxoethyl)glycine hydrazide is a compound of interest for research and development in various chemical and biological applications.
Formula:C6H15N7O3
InChI:InChI=1S/C6H15N7O3/c7-10-4(14)1-13(2-5(15)11-8)3-6(16)12-9/h1-3,7-9H2,(H,10,14)(H,11,15)(H,12,16)
InChI key:InChIKey=KGSXKXWCVWJCIW-UHFFFAOYSA-N
SMILES:N(CC(NN)=O)(CC(NN)=O)CC(NN)=O
Synonyms:- Glycine, N,N-bis(2-hydrazino-2-oxoethyl)-, hydrazide
- Glycine, N,N-bis(2-hydrazinyl-2-oxoethyl)-, hydrazide
- Nitrazine
- N,N-Bis(2-hydrazinyl-2-oxoethyl)glycine hydrazide
- AT 1902
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AT 1902
CAS:AT-1902 is a bio-active chemical.Formula:C6H15N7O3Color and Shape:SolidMolecular weight:233.23
