CymitQuimica logo

CAS 80155-95-9

:

defucogilvocarcin V

Description:
Defucogilvocarcin V, with the CAS number 80155-95-9, is a member of the gilvocarcin family, which are naturally occurring compounds known for their antitumor properties. These compounds are characterized by their complex polycyclic structures, which include a chromophore that contributes to their biological activity. Defucogilvocarcin V exhibits potent cytotoxic effects against various cancer cell lines, making it a subject of interest in cancer research. Its mechanism of action typically involves intercalation into DNA, leading to disruption of replication and transcription processes. Additionally, the compound may exhibit unique solubility and stability characteristics, influencing its bioavailability and therapeutic potential. As with many natural products, the extraction and purification processes can be challenging, and ongoing studies aim to optimize its use in clinical settings. Overall, defucogilvocarcin V represents a promising avenue for the development of novel anticancer therapies, although further research is necessary to fully understand its pharmacological profile and potential applications.
Formula:C21H16O5
InChI:InChI=1/C21H16O5/c1-4-11-8-14-18(16(9-11)24-2)13-10-17(25-3)19-12(6-5-7-15(19)22)20(13)26-21(14)23/h4-10,22H,1H2,2-3H3
Synonyms:
  • 6H-Benzo[d]naphtho[1,2-b]pyran-6-one, 8-ethenyl-1-hydroxy-10,12-dimethoxy-
  • 6H-Benzo(d)naphtho(1,2-b)pyran-6-one, 8-ethenyl-1-hydroxy-10,12-dimethoxy-
  • 8-Ethenyl-1-hydroxy-10,12-dimethoxy-6H-benzo[d]naphtho[1,2-b]pyran-6-one
  • defucogilvocarcin V
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.