CymitQuimica logo

CAS 80171-33-1

:

(5Z)-5-(4-hydroxybenzylidene)imidazolidine-2,4-dione

Description:
(5Z)-5-(4-hydroxybenzylidene)imidazolidine-2,4-dione, also known as a derivative of imidazolidine, is characterized by its unique structural features, including an imidazolidine ring and a benzylidene group with a hydroxyl substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the hydroxyl group. The imidazolidine moiety suggests that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding, which can influence its reactivity and stability. Additionally, the hydroxyl group can contribute to its potential biological activity, making it of interest in medicinal chemistry. The compound may also display specific optical properties, depending on its stereochemistry, and could be involved in various applications, including pharmaceuticals and agrochemicals. Its CAS number, 80171-33-1, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c13-7-3-1-6(2-4-7)5-8-9(14)12-10(15)11-8/h1-5,13H,(H2,11,12,14,15)/b8-5-
SMILES:c1cc(ccc1/C=C\1/C(=NC(=N1)O)O)O
Synonyms:
  • 2,4-imidazolidinedione, 5-[(4-hydroxyphenyl)methylene]-, (5Z)-
  • 5-(4-Hydroxybenzylidene)Imidazolidine-2,4-Dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.