CAS 80171-90-0
:1-{2-[({3-[(hexyloxy)methyl]phenyl}carbamoyl)oxy]ethyl}azepanium chloride
Description:
1-{2-[({3-[(hexyloxy)methyl]phenyl}carbamoyl)oxy]ethyl}azepanium chloride, with the CAS number 80171-90-0, is a quaternary ammonium compound characterized by its complex structure that includes an azepanium ring and a carbamoyl group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being cationic and soluble in polar solvents. Its structure suggests potential applications in various fields, including pharmaceuticals and materials science, due to its ability to interact with biological membranes and its surfactant properties. The presence of the hexyloxy group may enhance its lipophilicity, influencing its behavior in biological systems. Additionally, the chloride ion serves as a counterion, contributing to the overall stability and solubility of the compound in aqueous environments. Overall, this substance's unique characteristics stem from its intricate molecular architecture, which may impart specific functionalities relevant to its applications.
Formula:C22H37ClN2O3
InChI:InChI=1/C22H36N2O3.ClH/c1-2-3-4-9-16-26-19-20-11-10-12-21(18-20)23-22(25)27-17-15-24-13-7-5-6-8-14-24;/h10-12,18H,2-9,13-17,19H2,1H3,(H,23,25);1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Carbanilic acid, m-((hexyloxy)methyl)-, 2-(hexahydro-1H-azepin-1-yl)ethyl ester, hydrochloride
CAS:Carbanilic acid, m-((hexyloxy)methyl)-, 2-(hexahydro-1H-azepin-1-yl)ethyl ester, hydrochloride is a bioactive chemical.Formula:C22H37ClN2O3Color and Shape:SolidMolecular weight:412.99
