CAS 80173-27-9

S-benzyl-N-(4-methyl-2-oxo-2H-chromen-7-yl)-D-cysteinamide

Description:

S-benzyl-N-(4-methyl-2-oxo-2H-chromen-7-yl)-D-cysteinamide, with the CAS number 80173-27-9, is a synthetic compound that features a unique combination of a benzyl group, a cysteinamide moiety, and a chromen-7-yl structure. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties such as antioxidant or anti-inflammatory effects due to the presence of the chromenone structure. The cysteinamide component suggests potential reactivity with various biological targets, making it of interest for drug development. Its molecular structure indicates the presence of functional groups that can participate in hydrogen bonding and other interactions, influencing its solubility and stability. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, this compound represents a class of bioactive molecules that could be explored for therapeutic applications.

Formula: C₂₀H₂₀N₂O₃S

InChI: InChI=1/C20H20N2O3S/c1-13-9-19(23)25-18-10-15(7-8-16(13)18)22-20(24)17(21)12-26-11-14-5-3-2-4-6-14/h2-10,17H,11-12,21H2,1H3,(H,22,24)/t17-/m1/s1

SMILES: Cc1cc(=O)oc2cc(ccc12)N=C([C@@H](CSCc1ccccc1)N)O

H-Cys(Bzl)-AMC

CAS: 80173-27-9

A sensitive fluorogenic substrate for serum cystyl aminopeptidase (oxytocinase).

Formula: C₂₀H₂₀N₂O₃S

Purity: > 99%

Color and Shape: Whitish

Molecular weight: 368.46

Ref: 01-4007281

H-Cys(Bzl)-AMC

CAS: 80173-27-9

H-Cys(Bzl)-AMC is a mesocosm study that measures the effects of nutrient additions on coastal ecosystems. Collaboratively, academics and stakeholders work to analyze datasets from these experiments to diagnose the impacts of nutrient inputs on coastal systems. This exploratory initiative will help stakeholders understand the impacts of nutrient inputs on their ecosystems in order to make better decisions about how they manage their natural resources.

Formula: C₂₀H₂₀N₂O₃S

Purity: Min. 95%

Molecular weight: 368.45 g/mol

Ref: 3D-FC110483