CAS 80180-63-8

N-formyl-met-leu-phe-phe

Description:

N-formyl-met-leu-phe-phe, also known by its CAS number 80180-63-8, is a synthetic peptide that consists of a sequence of amino acids, specifically methionine (Met), leucine (Leu), phenylalanine (Phe), and another phenylalanine (Phe). This compound is characterized by the presence of a formyl group attached to the amino terminus, which can influence its biological activity and stability. Peptides like N-formyl-met-leu-phe-phe are often studied for their roles in biological processes, including their potential as signaling molecules or in immune responses. The structure of this peptide allows it to interact with various biological receptors, which may lead to diverse physiological effects. Additionally, its synthesis and characterization involve techniques such as solid-phase peptide synthesis and analytical methods like mass spectrometry and high-performance liquid chromatography (HPLC) to ensure purity and confirm the molecular structure. Overall, N-formyl-met-leu-phe-phe serves as an important model for understanding peptide behavior in biological systems.

Formula: C₃₀H₄₀N₄O₆S

InChI: InChI=1/C30H40N4O6S/c1-20(2)16-24(32-27(36)23(31-19-35)14-15-41-3)28(37)33-25(17-21-10-6-4-7-11-21)29(38)34-26(30(39)40)18-22-12-8-5-9-13-22/h4-13,19-20,23-26H,14-18H2,1-3H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38)(H,39,40)/t23-,24-,25-,26-/m0/s1

SMILES: CC(C)C[C@@H](C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](Cc1ccccc1)C(=O)O)O)O)N=C([C@H](CCSC)N=CO)O

Synonyms:

• For-Met-Leu-Phe-Phe-OH
• N-formyl-L-methionyl-L-leucyl-L-phenylalanyl-L-phenylalanine

For-Met-Leu-Phe-Phe-OH

CAS: 80180-63-8

For-Met-Leu-Phe-Phe-OH is a putative antiinflammatory agent that has been shown to inhibit the production of c-reactive protein, which is an acute phase reactant. It also inhibits chemotaxis and degranulation in leukocytes. This drug has been shown to have a constant activity against bacterial infections, but it is not yet known whether this activity is due to its antiinflammatory properties or other modes of action. For-Met-Leu-Phe-Phe-OH binds to phosphatidylinositol 3 kinase and inhibits receptor binding in neutrophils and monocytes, which may be responsible for its chemotactic effects.

Formula: C₃₀H₄₀N₄O₆S

Purity: Min. 95%

Molecular weight: 584.73 g/mol

Ref: 3D-FF109233