CAS 80194-18-9

3-Chloro-5-(trifluoromethyl)pyridine-2-carboxylic acid

Description:

3-Chloro-5-(trifluoromethyl)pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2-position with a carboxylic acid group and at the 3-position with a chlorine atom. Additionally, it features a trifluoromethyl group at the 5-position, contributing to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The presence of the carboxylic acid group allows for potential interactions in various chemical reactions, including esterification and amidation. The chlorine atom can also participate in nucleophilic substitution reactions. Due to these characteristics, 3-Chloro-5-(trifluoromethyl)pyridine-2-carboxylic acid may find applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of compounds with specific biological activities or chemical functionalities.

Formula: C₇H₃ClF₃NO₂

InChI: InChI=1/C7H3ClF3NO2/c8-4-1-3(7(9,10)11)2-12-5(4)6(13)14/h1-2H,(H,13,14)

SMILES: c1c(cnc(c1Cl)C(=O)O)C(F)(F)F

Synonyms:

• 2-Pyridinecarboxylic Acid, 3-Chloro-5-(Trifluoromethyl)-
• 3-Chloro-5-(trifluoromethyl)picolinic acid

Benzhydryl (6R,7S)-7-((R)-6-(benzhydryloxy)-6-oxo-5-(((2,2,2-trichloroethoxy)carbonyl)amino)hexanamido)-7-methoxy-3-(((1-methyl-1H-tetrazol-5-yl)thio)methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate

CAS: 80194-18-9

Formula: C₄₆H₄₄Cl₃N₇O₉S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 1009.3721

Ref: IN-DA00G47E

3-Chloro-5-(trifluoromethyl)picolinic acid

CAS: 80194-18-9

3-Chloro-5-(trifluoromethyl)picolinic acid

Purity: 98%

Molecular weight: 225.55g/mol

Ref: 54-PC108794