CAS 80196-04-9
:1-Iodoethyl ethyl carbonate
Description:
1-Iodoethyl ethyl carbonate, with the CAS number 80196-04-9, is an organic compound characterized by the presence of an iodo group and an ethyl carbonate functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its moderate volatility. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The presence of the iodine atom can impart unique reactivity, particularly in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the ethyl carbonate moiety contributes to its stability and potential use in the synthesis of other chemical compounds. Safety considerations should be taken into account when handling this substance, as it may pose health risks if inhaled or ingested, and appropriate protective measures should be employed. Overall, 1-Iodoethyl ethyl carbonate serves as an important building block in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C5H9IO3
InChI:InChI=1/C5H9IO3/c1-3-8-5(7)9-4(2)6/h4H,3H2,1-2H3
SMILES:CCOC(=O)OC(C)I
Synonyms:- Carbonic Acid, Ethyl 1-Iodoethyl Ester
- Ethyl 1-iodoethyl carbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.