CAS 80199-92-4

1-(benzyloxy)-4-(3-bromopropoxy)benzene

Description:

1-(Benzyloxy)-4-(3-bromopropoxy)benzene, with the CAS number 80199-92-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a benzyloxy group and a 3-bromopropoxy group. The presence of the benzyloxy group enhances its solubility in organic solvents, while the 3-bromopropoxy group introduces a bromine atom, which can influence the compound's reactivity and potential applications in synthesis. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may increase in the presence of nucleophiles or under specific catalytic conditions. The bromine atom can also serve as a site for further chemical modifications, making it a useful intermediate in organic synthesis. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the solvent environment. Overall, 1-(benzyloxy)-4-(3-bromopropoxy)benzene is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₁₆H₁₇BrO₂

InChI: InChI=1/C16H17BrO2/c17-11-4-12-18-15-7-9-16(10-8-15)19-13-14-5-2-1-3-6-14/h1-3,5-10H,4,11-13H2

SMILES: c1ccc(cc1)COc1ccc(cc1)OCCCBr

1-(Benzyloxy)-4-(3-bromopropoxy)benzene

CAS: 80199-92-4

1-(Benzyloxy)-4-(3-bromopropoxy)benzene

Purity: ≥95%

Molecular weight: 321.21g/mol

Ref: 54-OR12024