CAS 80212-12-0
:4-chloro-1-(3,4-dichlorophenyl)butan-1-one
Description:
4-Chloro-1-(3,4-dichlorophenyl)butan-1-one is an organic compound characterized by its structure, which includes a butanone backbone substituted with a chloro group and a dichlorophenyl moiety. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its unique chemical properties. The presence of multiple chlorine atoms contributes to its reactivity and may influence its biological activity. As a halogenated compound, it may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry. Safety considerations are important when handling this substance, as halogenated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards. Overall, 4-chloro-1-(3,4-dichlorophenyl)butan-1-one is a compound of interest for research and industrial applications, warranting further investigation into its properties and effects.
Formula:C10H9Cl3O
InChI:InChI=1/C10H9Cl3O/c11-5-1-2-10(14)7-3-4-8(12)9(13)6-7/h3-4,6H,1-2,5H2
SMILES:C(CC(=O)c1ccc(c(c1)Cl)Cl)CCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.