CAS 80221-11-0
:1-n-Butyl-4-[(4-n-butylphenyl)ethynyl]benzene
Description:
1-n-Butyl-4-[(4-n-butylphenyl)ethynyl]benzene, with the CAS number 80221-11-0, is an organic compound characterized by its structure, which includes a butyl group and an ethynyl linkage attached to a phenyl ring. This compound is part of the class of alkynyl-substituted aromatic compounds, which are known for their potential applications in organic electronics, particularly in the development of organic light-emitting diodes (OLEDs) and other optoelectronic devices. The presence of the butyl groups enhances solubility in organic solvents, making it suitable for various synthesis and application processes. Additionally, the ethynyl group contributes to the compound's electronic properties, potentially allowing for tunable photophysical characteristics. Its stability and reactivity can be influenced by the substituents on the aromatic rings, which can affect its performance in electronic applications. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the importance of molecular design in developing advanced materials.
Formula:C22H26
InChI:InChI=1/C22H26/c1-3-5-7-19-9-13-21(14-10-19)17-18-22-15-11-20(12-16-22)8-6-4-2/h9-16H,3-8H2,1-2H3
SMILES:CCCCc1ccc(cc1)C#Cc1ccc(CCCC)cc1
Synonyms:- 1,1'-(1,2-Ethynediyl)Bis[4-Butylbenzene]
- 1,1'-Ethyne-1,2-diylbis(4-butylbenzene)
- 1-Butyl-4-[2-(4-butylphenyl)-1-ethynyl]benzene
- 4R D1Uu1R D4 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-n-Butyl-4-[(4-butylphenyl)ethynyl]benzene, 99+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C22H26Purity:99+%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:290.45


