CAS 80222-25-9
:2-Fluoro-4-propylphenol
Description:
2-Fluoro-4-propylphenol, with the CAS number 80222-25-9, is an organic compound characterized by the presence of a fluorine atom and a propyl group attached to a phenolic structure. This compound features a hydroxyl (-OH) group, which imparts typical phenolic properties, such as moderate acidity and the ability to form hydrogen bonds. The fluorine substitution at the second position and the propyl group at the fourth position of the phenol ring influence its chemical reactivity and physical properties, including solubility and boiling point. Generally, compounds like 2-Fluoro-4-propylphenol may exhibit antimicrobial or antifungal activities, making them of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the fluorine atom can enhance lipophilicity, potentially affecting the compound's bioavailability and interaction with biological systems. Safety data should be consulted for handling and usage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H11FO
InChI:InChI=1S/C9H11FO/c1-2-3-7-4-5-9(11)8(10)6-7/h4-6,11H,2-3H2,1H3
InChI key:InChIKey=KMWKHQSAKNXIIW-UHFFFAOYSA-N
SMILES:C(CC)C1=CC(F)=C(O)C=C1
Synonyms:- Phenol, 2-fluoro-4-propyl-
- 2-Fluoro-4-propylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
