CymitQuimica logo

CAS 80222-26-0

:

4-Butyl-2-fluorophenol

Description:
4-Butyl-2-fluorophenol is an organic compound characterized by the presence of a fluorine atom and a butyl group attached to a phenolic structure. It features a phenol ring, which is a benzene ring with a hydroxyl (-OH) group, and in this case, the hydroxyl group is located at the para position relative to the butyl group and the fluorine atom at the meta position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its unique chemical properties. The presence of the fluorine atom can enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Additionally, the butyl group contributes to the hydrophobic character of the molecule. As with many organic compounds, safety precautions should be taken when handling 4-butyl-2-fluorophenol, as it may pose health and environmental risks.
Formula:C10H13FO
InChI:InChI=1S/C10H13FO/c1-2-3-4-8-5-6-10(12)9(11)7-8/h5-7,12H,2-4H2,1H3
InChI key:InChIKey=IIFZJCUEUOVHFO-UHFFFAOYSA-N
SMILES:C(CCC)C1=CC(F)=C(O)C=C1
Synonyms:
  • Phenol, 4-butyl-2-fluoro-
  • 4-Butyl-2-fluorophenol
  • Phenol, 4-butyl-2-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.