CAS 80223-79-6
:2-Methoxy-5-(2-oxopropyl)benzenesulfonyl chloride
Description:
2-Methoxy-5-(2-oxopropyl)benzenesulfonyl chloride, with the CAS number 80223-79-6, is an organic compound characterized by the presence of a sulfonyl chloride functional group, which is known for its reactivity in various chemical transformations. This compound features a methoxy group and a ketone moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions, which are valuable in organic synthesis, particularly in the formation of sulfonamides and other derivatives. Additionally, the presence of the methoxy group can influence its solubility and reactivity, making it more versatile in synthetic applications. Due to its reactive nature, appropriate safety measures should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture.
Formula:C10H11ClO4S
InChI:InChI=1S/C10H11ClO4S/c1-7(12)5-8-3-4-9(15-2)10(6-8)16(11,13)14/h3-4,6H,5H2,1-2H3
InChI key:InChIKey=JCEWAIRJQKPKBH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(OC)C=CC(CC(C)=O)=C1
Synonyms:- 2-Methoxy-5-(2-oxopropyl)benzenesulfonyl chloride
- 3-(Chlorosulfonyl)-4-methoxyphenylacetone
- Benzenesulfonyl chloride, 2-methoxy-5-(2-oxopropyl)-
- 5-ACETONYL-2-METHOXYBENZENESULPHONYLCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
