CAS 802276-49-9

2-amino-5-phenyl-1,3-thiazole-4-carboxylic acid

Description:

2-Amino-5-phenyl-1,3-thiazole-4-carboxylic acid is a heterocyclic compound featuring a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound is characterized by the presence of an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as an acid and a base. The phenyl group attached to the thiazole ring enhances its aromatic properties and may influence its reactivity and solubility. The thiazole structure is known for its biological activity, making this compound of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding, which can affect its solubility in different solvents. Additionally, the compound may exhibit specific optical properties due to its chiral centers, depending on the configuration of the substituents. Overall, 2-amino-5-phenyl-1,3-thiazole-4-carboxylic acid is a versatile compound with potential applications in pharmaceuticals and biochemistry.

Formula: C₁₀H₈N₂O₂S

InChI: InChI=1/C10H8N2O2S/c11-10-12-7(9(13)14)8(15-10)6-4-2-1-3-5-6/h1-5H,(H2,11,12)(H,13,14)

SMILES: c1ccc(cc1)c1c(C(=O)O)[nH]c(=N)s1

Synonyms:

• 2-Amino-5-phenyl-4-thiazolecarboxylic acid
• 802276-49-9

2-Amino-5-phenyl-1,3-thiazole-4-carboxylic acid

CAS: 802276-49-9

2-Amino-5-phenyl-1,3-thiazole-4-carboxylic acid is a carboxylic acid that inhibits the activity of anhydrase. It was synthesized by the reaction of 2,5-diaminothiazole with ethyl chloroformate and sodium hydroxide. The synthesis of this compound is an important step in the total synthesis of erythromycin A. Functional groups on this molecule include a carboxylic group, an amide group, and a phenyl ring. The functional groups on this molecule are responsible for its inhibitory effects on anhydrase enzymes.

Formula: C₁₀H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 220.25 g/mol

Ref: 3D-CHB27649