CymitQuimica logo

CAS 80228-93-9

:

Thiadifluor

Description:
Thiadifluor, with the CAS number 80228-93-9, is a chemical compound that belongs to the class of organofluorine compounds. It is characterized by the presence of sulfur and fluorine atoms in its molecular structure, which contributes to its unique chemical properties. Thiadifluor is typically recognized for its potential applications in various fields, including agriculture as a pesticide or herbicide, due to its ability to interact with biological systems. The compound may exhibit high stability and low volatility, making it suitable for use in formulations that require persistence in the environment. Additionally, its fluorinated nature often imparts hydrophobic characteristics, influencing its solubility and reactivity. Safety and environmental considerations are crucial when handling thiadifluor, as with many fluorinated compounds, due to potential toxicity and ecological impact. Proper safety protocols should be followed to mitigate risks associated with exposure. Overall, thiadifluor represents a specialized chemical with specific applications and properties that warrant careful study and handling.
Formula:C12H7ClF6N4S
InChI:InChI=1S/C12H7ClF6N4S/c1-20-10-23(7-4-2-6(13)3-5-7)8(21-11(14,15)16)9(24-10)22-12(17,18)19/h2-5H,1H3
InChI key:InChIKey=HBLSGPQATABNRY-UHFFFAOYSA-N
SMILES:N(C(F)(F)F)=C1N(C(=NC)SC1=NC(F)(F)F)C2=CC=C(Cl)C=C2
Synonyms:
  • Thiadifluor
  • N,N′-[3-(4-Chlorophenyl)-2-(methylimino)-4,5-thiazolidinediylidene]bis[1,1,1-trifluoromethanamine]
  • Methanamine, N,N′-[3-(4-chlorophenyl)-2-(methylimino)-4,5-thiazolidinediylidene]bis[1,1,1-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.