CymitQuimica logo

CAS 802325-29-7

:

(5-fluoro-2-pyridyl)methanol

Description:
(5-Fluoro-2-pyridyl)methanol is an organic compound characterized by the presence of a pyridine ring substituted with a fluorine atom and a hydroxymethyl group. The molecular structure features a five-membered aromatic ring, which contributes to its stability and potential reactivity. The fluorine atom enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The hydroxymethyl group (-CH2OH) provides sites for hydrogen bonding, which can affect solubility and interaction with biological targets. This compound may exhibit properties such as moderate polarity and potential for hydrogen bonding, which can influence its behavior in various chemical environments. It is often studied for its potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many organic compounds, safety and handling precautions should be observed, as the effects of exposure can vary based on concentration and route of exposure.
Formula:C6H6FNO
InChI:InChI=1/C6H6FNO/c7-5-1-2-6(4-9)8-3-5/h1-3,9H,4H2
InChI key:BKLMFAZXPZQITJ-UHFFFAOYSA-N
SMILES:c1cc(CO)ncc1F
Synonyms:
  • (5-Fluoropyridin-2-yl)methanol
  • 2-Pyridinemethanol, 5-Fluoro-
  • 5-Fluoro-2-hydroxymethylpyridine
Found 4 products.