CAS 80238-38-6

(2-acetylhydrazinylidene)(phenyl)acetic acid

Description:

(2-acetylhydrazinylidene)(phenyl)acetic acid, with the CAS number 80238-38-6, is a chemical compound that features a hydrazine derivative linked to a phenylacetic acid moiety. This compound typically exhibits characteristics associated with both hydrazine and carboxylic acid functional groups, which may impart properties such as moderate solubility in polar solvents and potential reactivity due to the presence of the hydrazine functional group. The compound may participate in various chemical reactions, including condensation and substitution reactions, owing to its functional groups. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. The presence of the phenyl group can enhance lipophilicity, potentially influencing its pharmacokinetic properties. Overall, the compound's unique structure suggests it may have applications in organic synthesis or as a potential pharmaceutical agent, although specific biological or chemical behavior would require further empirical investigation.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1/C10H10N2O3/c1-7(13)11-12-9(10(14)15)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,13)(H,14,15)

2-(2-Acetylhydrazineylidene)-2-phenylacetic acid

CAS: 80238-38-6

2-(2-Acetylhydrazineylidene)-2-phenylacetic acid

Purity: 98%

Molecular weight: 206.2g/mol

Ref: 54-OR1060594