CAS 80245-33-6

2,3-Dichloro-5-methylbenzotrifluoride

Description:

2,3-Dichloro-5-methylbenzotrifluoride, with the CAS number 80245-33-6, is an aromatic compound characterized by the presence of two chlorine atoms and a methyl group attached to a benzene ring that is also substituted with three fluorine atoms. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively high stability and low volatility. It is often used as an intermediate in the synthesis of various organic compounds and may serve as a solvent in certain chemical processes. The presence of multiple halogen substituents enhances its reactivity, making it useful in electrophilic aromatic substitution reactions. Additionally, 2,3-Dichloro-5-methylbenzotrifluoride exhibits properties such as hydrophobicity and resistance to degradation, which can influence its environmental behavior and toxicity. Safety precautions are necessary when handling this compound due to potential health hazards associated with exposure to halogenated organic compounds.

Formula: C₈H₅Cl₂F₃

InChI: InChI=1/C8H5Cl2F3/c1-4-2-5(8(11,12)13)7(10)6(9)3-4/h2-3H,1H3

SMILES: Cc1cc(c(c(c1)Cl)Cl)C(F)(F)F

Synonyms:

• 1,2-Dichloro-5-Methyl-3-(Trifluoromethyl)Benzene