CAS 80246-70-4
:Ethyl cycloheptylacetate
Description:
Ethyl cycloheptylacetate is an organic compound classified as an ester, formed from the reaction of cycloheptyl alcohol and acetic acid. It typically appears as a colorless to pale yellow liquid with a pleasant, fruity odor, making it useful in flavor and fragrance applications. The compound is characterized by its relatively low boiling point and moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic cycloheptyl group. Ethyl cycloheptylacetate is known for its stability under normal conditions, although it may undergo hydrolysis in the presence of strong acids or bases. Its molecular structure features a cycloheptyl ring, which contributes to its unique properties and potential applications in various industries, including perfumery and food flavoring. Safety data indicates that, like many esters, it should be handled with care to avoid skin and eye irritation. Overall, ethyl cycloheptylacetate is valued for its aromatic qualities and versatility in chemical synthesis.
Formula:C11H20O2
InChI:InChI=1/C11H20O2/c1-2-13-11(12)9-10-7-5-3-4-6-8-10/h10H,2-9H2,1H3
SMILES:CCOC(=O)CC1CCCCCC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-cycloheptylacetate
CAS:<p>Ethyl 2-cycloheptylacetate is an organic compound with the formula CH3CH2C6H11CH2CO2Et. It is a colorless liquid which is soluble in water and ether, but not in most common organic solvents. It has been shown to be effective in inhibiting the development of atherosclerosis in mice by interfering with cholesterol synthesis. In addition, it has been shown to inhibit the proliferation of vascular smooth muscle cells and to alter their gene expression profile. The compound also inhibits angiotensin II-induced hypertension, as well as norepinephrine-induced vasoconstriction and platelet aggregation.</p>Formula:C11H20O2Purity:Min. 95%Molecular weight:184.28 g/mol




