CAS 80254-87-1

[1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-, methyl ester

Description:

[1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-, methyl ester, commonly referred to as methyl 4-fluoro-4'-biphenyl-4-carboxylate, is an organic compound characterized by its biphenyl structure with a carboxylic acid group and a fluorine substituent. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the fluorine atom can influence its chemical reactivity and physical properties, such as boiling and melting points, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The methyl ester functional group contributes to its reactivity, allowing for further chemical modifications. Additionally, this compound may exhibit specific biological activities, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1S/C14H11FO2/c1-17-14(16)12-4-2-10(3-5-12)11-6-8-13(15)9-7-11/h2-9H,1H3

InChI key: InChIKey=ACJGXBVKOGLYEL-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC=C(C=C1)C2=CC=C(F)C=C2

Synonyms:

• Methyl 4′-fluoro-1,1′-biphenyl-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 4′-fluoro-, methyl ester
• 4′-Fluorobiphenyl-4-carboxylic acid methyl ester

Methyl 4'-fluorobiphenyl-4-carboxylate

CAS: 80254-87-1

Formula: C₁₄H₁₁FO₂

Purity: 95%

Molecular weight: 230.2343

Ref: IN-DA00GJ81

Methyl 4'-fluoro-1,1'-biphenyl-4-carboxylate

CAS: 80254-87-1

Methyl 4'-fluoro-1,1'-biphenyl-4-carboxylate

Purity: ≥95%

Molecular weight: 230.23g/mol

Ref: 54-PC300616