CAS 802541-49-7

Ethyl 6-[(dimethylamino)methylene]-4,5,6,7-tetrahydro-1,4,4-trimethyl-7-oxo-1H-indazole-3-carboxylate

Description:

Ethyl 6-[(dimethylamino)methylene]-4,5,6,7-tetrahydro-1,4,4-trimethyl-7-oxo-1H-indazole-3-carboxylate, identified by CAS number 802541-49-7, is a synthetic organic compound characterized by its complex indazole structure. This compound features a tetrahydroindazole core, which contributes to its potential biological activity. The presence of the dimethylamino group suggests that it may exhibit basic properties, potentially influencing its solubility and reactivity. The ethyl ester functional group indicates that it can undergo hydrolysis, making it reactive in various chemical environments. Additionally, the presence of multiple methyl groups may enhance lipophilicity, affecting its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, although specific biological activities and mechanisms of action would require further investigation. Overall, its structural complexity and functional groups suggest a versatile compound with potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₆H₂₃N₃O₃

InChI: InChI=1S/C16H23N3O3/c1-7-22-15(21)12-11-13(19(6)17-12)14(20)10(9-18(4)5)8-16(11,2)3/h9H,7-8H2,1-6H3

InChI key: InChIKey=PYGISCRUAORRMV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(C(=O)C(=CN(C)C)CC2(C)C)N(C)N1

Synonyms:

• Ethyl 6-[(dimethylamino)methylene]-4,5,6,7-tetrahydro-1,4,4-trimethyl-7-oxo-1H-indazole-3-carboxylate
• 1H-Indazole-3-carboxylic acid, 6-[(dimethylamino)methylene]-4,5,6,7-tetrahydro-1,4,4-trimethyl-7-oxo-, ethyl ester