CAS 802559-15-5
:2-phenyl-3-(piperidin-1-yl)propan-1-ol
Description:
2-Phenyl-3-(piperidin-1-yl)propan-1-ol, identified by its CAS number 802559-15-5, is a chemical compound characterized by its structural features that include a phenyl group and a piperidine moiety attached to a propanol backbone. This compound typically exhibits properties associated with both alcohols and amines, such as the ability to form hydrogen bonds due to the hydroxyl (-OH) group and potential basicity from the piperidine nitrogen. It may display moderate solubility in polar solvents like water and higher solubility in organic solvents. The presence of the phenyl group can contribute to hydrophobic interactions, influencing its biological activity and pharmacokinetics. Compounds of this type may be of interest in medicinal chemistry, particularly for their potential applications in drug development, as they can interact with various biological targets. Additionally, the stereochemistry of the compound can play a significant role in its biological activity, making it important to consider in synthesis and application.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c16-12-14(13-7-3-1-4-8-13)11-15-9-5-2-6-10-15/h1,3-4,7-8,14,16H,2,5-6,9-12H2
InChI key:SKVSDAJJKLVHSG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(CN1CCCCC1)CO
Synonyms:- 1-Piperidinepropanol, beta-phenyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
