
CAS 802607-27-8
:3,4,5,6-Tetrahydro-N-(2-methylphenyl)-2H-azepin-7-amine
Description:
3,4,5,6-Tetrahydro-N-(2-methylphenyl)-2H-azepin-7-amine is a chemical compound characterized by its azepine ring structure, which is a seven-membered cyclic amine. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the azepine ring, resulting in a saturated structure. The presence of the N-(2-methylphenyl) substituent suggests that it has an aromatic component, which can influence its chemical reactivity and biological activity. The amine functional group at the 7-position contributes to its basicity and potential for hydrogen bonding. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions, solubility, and stability would depend on the surrounding conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in a laboratory setting.
Formula:C13H18N2
InChI:InChI=1S/C13H18N2/c1-11-7-4-5-8-12(11)15-13-9-3-2-6-10-14-13/h4-5,7-8H,2-3,6,9-10H2,1H3,(H,14,15)
InChI key:InChIKey=GUADJDCDXSVMCE-UHFFFAOYSA-N
SMILES:N(C1=C(C)C=CC=C1)C=2CCCCCN2
Synonyms:- 1H-Azepine, hexahydro-2-(o-tolylimino)-
- 3,4,5,6-Tetrahydro-N-(2-methylphenyl)-2H-azepin-7-amine
- 2H-Azepin-7-amine, 3,4,5,6-tetrahydro-N-(2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.