CAS 80274-85-7

Imidodicarbonimidic diamide, N-methyl-, hydrochloride (1:?)

Description:

Imidodicarbonimidic diamide, N-methyl-, hydrochloride, with the CAS number 80274-85-7, is a chemical compound that belongs to the class of guanidine derivatives. It is characterized by its structural features, which include multiple imine and amine functional groups, contributing to its potential reactivity and biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. The presence of the hydrochloride indicates that it is a salt formed from the reaction of the base with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. Imidodicarbonimidic diamide derivatives are often studied for their applications in pharmaceuticals and biochemistry, particularly due to their ability to interact with biological systems. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₃H₉N₅·xClH

InChI: InChI=1S/C3H9N5.ClH/c1-7-3(6)8-2(4)5;/h1H3,(H6,4,5,6,7,8);1H

InChI key: InChIKey=AAYCPBAOUJRPIC-UHFFFAOYSA-N

SMILES: C(NC(=N)N)(NC)=N.Cl

Synonyms:

• Imidodicarbonimidic diamide, N-methyl-, hydrochloride (1:?)
• Imidodicarbonimidic diamide, N-methyl-, hydrochloride

Imidodicarbonimidic diamide, N-methyl-, hydrochloride (1:?)

CAS: 80274-85-7

Formula: C₃H₁₀ClN₅

Molecular weight: 151.5980

Ref: IN-DA01X4W2