CAS 80278-72-4

ethyl 3-[(2-ethoxy-2-oxoethyl)sulfanyl]propanoate

Description:

Ethyl 3-[(2-ethoxy-2-oxoethyl)sulfanyl]propanoate, identified by its CAS number 80278-72-4, is an organic compound characterized by its ester functional group, which is typical of many ethyl esters. This compound features a propanoate backbone, indicating the presence of a three-carbon chain with a carboxylate group. The molecule also contains a thioether functional group due to the sulfanyl moiety, which contributes to its reactivity and potential applications in organic synthesis. The ethoxy group suggests that the compound may exhibit moderate polarity, influencing its solubility in various solvents. Additionally, the presence of the keto group (2-oxo) indicates potential for tautomerization and reactivity in condensation reactions. Overall, this compound may be of interest in medicinal chemistry and synthetic organic chemistry due to its unique structural features and potential biological activity. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₉H₁₆O₄S

InChI: InChI=1/C9H16O4S/c1-3-12-8(10)5-6-14-7-9(11)13-4-2/h3-7H2,1-2H3

SMILES: CCOC(=O)CCSCC(=O)OCC

Ethyl 3-[(2-Ethoxy-2-oxoethyl)sulfanyl]propanoate

CAS: 80278-72-4

Ethyl 3-[(2-Ethoxy-2-oxoethyl)sulfanyl]propanoate

Purity: 95%

Molecular weight: 220.29g/mol

Ref: 54-OR1004126