CAS 80279-24-9

(11S,11aS)-9-hydroxy-11-(1H-indol-3-yl)-1,2,3,10,11,11a-hexahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one

Description:

The chemical substance known as (11S,11aS)-9-hydroxy-11-(1H-indol-3-yl)-1,2,3,10,11,11a-hexahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one, with the CAS number 80279-24-9, is a complex organic compound characterized by its unique bicyclic structure that incorporates both indole and benzodiazepine moieties. This compound features a hydroxyl group at the 9-position, contributing to its potential biological activity. The stereochemistry indicated by the (11S,11aS) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's pharmacological properties. Typically, compounds of this nature may exhibit interactions with various biological targets, potentially leading to applications in medicinal chemistry, particularly in the development of therapeutic agents. The presence of multiple rings and functional groups suggests that it may engage in diverse chemical interactions, making it a subject of interest for further research in drug design and development. As with many complex organic molecules, its solubility, stability, and reactivity would depend on the specific conditions under which it is studied.

Formula: C₂₀H₁₉N₃O₂

InChI: InChI=1/C20H19N3O2/c24-17-9-3-6-13-19(17)22-18(16-8-4-10-23(16)20(13)25)14-11-21-15-7-2-1-5-12(14)15/h1-3,5-7,9,11,16,18,21-22,24H,4,8,10H2/t16-,18-/m0/s1

SMILES: c1ccc2c(c1)c(c[nH]2)[C@H]1[C@@H]2CCCN2C(=O)c2cccc(c2N1)O

Tilivalline

CAS: 80279-24-9

Applications Tilivalline, is a metabolite from Klebsiella oxytoca. Tilivalline, is shown to be cytotoxin, and the key event causing Antibiotic-Associated Hemorrhagic Colitis.
References Mori, Sh., et al.: Tetrahedron, 47, No.27, 5051 (1991); Nagasaka, T., et al.: Tetrahedron Lett., 14, 1871 (1989);

Formula: C₂₀H₁₉N₃O₂

Color and Shape: Light Brown

Molecular weight: 333.38

Ref: TR-T440350

Tilivalline

CAS: 80279-24-9

Tilivalline is a compound that belongs to the class of 3-hydroxyanthranilic acid synthase inhibitors. It prevents the synthesis of 3-hydroxyanthranilic acid by binding to the enzyme and inhibiting its activity. The stereoselective inhibitory effect of tilivalline on bacterial cells has been demonstrated using mammalian cells in culture. Tilivalline also inhibits cellular respiration, resulting in inhibition of fatty acid synthesis and production of chloride ions, which can lead to cell death due to hypotonic shock. Tilivalline has shown chemical diversity, with a variety of hydroxy groups including one at the 3-position, which may confer additional activity against microbial pathogens.

Formula: C₂₀H₁₉N₃O₂

Purity: Min. 95%

Molecular weight: 333.4 g/mol

Ref: 3D-FDA27924