CAS 80284-63-5
:2-Chloro-5-formylbenzenesulfonic acid
Description:
2-Chloro-5-formylbenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of a chloro group, a formyl group, and a sulfonic acid group attached to a benzene ring. This compound typically appears as a solid or crystalline substance and is soluble in water due to the sulfonic acid functionality, which enhances its polarity. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition, making it useful in organic synthesis. The chloro substituent can also serve as a site for further chemical modifications. This compound is often utilized in the synthesis of dyes, pharmaceuticals, and other organic compounds, owing to its reactive functional groups. Safety data sheets should be consulted for handling precautions, as it may pose health risks if ingested or inhaled. Overall, 2-Chloro-5-formylbenzenesulfonic acid is a versatile intermediate in chemical synthesis with specific reactivity due to its functional groups.
Formula:C7H5ClO4S
InChI:InChI=1/C7H5ClO4S/c8-6-2-1-5(4-9)3-7(6)13(10,11)12/h1-4H,(H,10,11,12)
InChI key:InChIKey=WASOCELOYFJJIU-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(C=O)=CC=C1Cl
Synonyms:- 2-Chloro-5-formylbenzenesulphonic acid
- 2-Chloro-5-formylbenzenesulfonic acid
- 2-chloro-5-formylbenzenesulfonic acid
- Benzenesulfonic acid, 2-chloro-5-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-3-Sulfobenzaldehyde Triethylamine Salt
CAS:Formula:C7H5ClO4S·Et3NMolecular weight:220.62 101.19
