
CAS 802894-10-6
:5-(Methylsulfonyl)-2-pyridinemethanol
Description:
5-(Methylsulfonyl)-2-pyridinemethanol is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and a methylsulfonyl group (-SO2CH3) attached to the pyridine ring, contributing to its unique chemical properties. The presence of the hydroxymethyl group provides potential for hydrogen bonding, enhancing its solubility in polar solvents. The methylsulfonyl group is known for its ability to act as a leaving group in various chemical reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. Overall, 5-(Methylsulfonyl)-2-pyridinemethanol is a versatile compound with applications in both synthetic chemistry and potentially in medicinal chemistry, depending on its biological activity.
Formula:C7H9NO3S
InChI:InChI=1S/C7H9NO3S/c1-12(10,11)7-3-2-6(5-9)8-4-7/h2-4,9H,5H2,1H3
InChI key:InChIKey=VSEUBPWEWYGUTG-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C=1C=CC(CO)=NC1
Synonyms:- 5-(Methylsulfonyl)-2-pyridinemethanol
- 2-Pyridinemethanol, 5-(methylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.