
CAS 80290-99-9
:Cobalt, [bis[μ-[[1,2-diphenyl-1,2-ethanedione 1,2-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN1,κN1′,κN2,κN2′]-, (SP-4-1)-
Description:
Cobalt, bis[μ-[[1,2-diphenyl-1,2-ethanedione 1,2-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN1,κN1′,κN2,κN2′]-, with CAS number 80290-99-9, is a coordination compound featuring cobalt as the central metal ion. This complex is characterized by its unique ligand structure, which includes a bis(oxime) derived from 1,2-diphenyl-1,2-ethanedione, coordinating through nitrogen and oxygen atoms. The presence of tetrafluorodiborate anions contributes to its stability and solubility properties. The compound exhibits interesting electronic and magnetic properties due to the cobalt ion, which can exist in multiple oxidation states, typically +2 or +3. Its coordination environment is influenced by the geometry of the ligands, often leading to octahedral or tetrahedral arrangements. This compound may have applications in catalysis, materials science, or as a precursor for other cobalt-based materials. Additionally, its unique structural features make it a subject of interest in coordination chemistry and the study of metal-ligand interactions.
Formula:C28H20B2CoF4N4O4
InChI:InChI=1S/C28H20B2F4N4O4.Co/c31-29(32)39-35-25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)36-40-30(33,34)42-38-28(24-19-11-4-12-20-24)27(37-41-29)23-17-9-3-10-18-23;/h1-20H;/q-2;+2
InChI key:InChIKey=AYGPFKXJJZAXJV-UHFFFAOYSA-N
SMILES:[F-][B+3]1([F-])[O-][N]=2[Co+2]34[N](=C(C(=[N]3[O-]1)C5=CC=CC=C5)C6=CC=CC=C6)[O-][B+3]([F-])([F-])[O-][N]4=C(C2C7=CC=CC=C7)C8=CC=CC=C8
Synonyms:- Ethanedione, diphenyl-, dioxime, boron-cobalt complex
- Cobalt, [bis[μ-[[diphenylethanedione di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN,κN′,κN′′,κN′′′]-, (SP-4-1)-
- Cobalt, [bis[μ-[(diphenylethanedione dioximato)(2-)-O:O′]]tetrafluorodiborato(2-)-N,N′,N′′,N′′′]-, (SP-4-1)-
- Borate(2-), bis[μ-[(diphenylethanedione dioximato)(2-)-O:O′]]tetrafluorodi-, cobalt complex
- Cobalt, [bis[μ-[[1,2-diphenyl-1,2-ethanedione 1,2-di(oximato-κO)](2-)]]tetrafluorodiborato(2-)-κN1,κN1′,κN2,κN2′]-, (SP-4-1)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
