
CAS 80304-43-4
:4-(1-Methylethyl)-1H-imidazole-5-carboxylic acid
Description:
4-(1-Methylethyl)-1H-imidazole-5-carboxylic acid, identified by its CAS number 80304-43-4, is an organic compound featuring an imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a carboxylic acid functional group (-COOH) at the 5-position of the imidazole ring and an isopropyl group (1-methylethyl) at the 4-position. The presence of these functional groups contributes to its potential as a biologically active molecule, possibly influencing its solubility, reactivity, and interaction with biological systems. The imidazole moiety is known for its role in various biochemical processes, including enzyme catalysis and coordination with metal ions. Additionally, the compound may exhibit properties such as acidity due to the carboxylic acid group, and it may participate in hydrogen bonding, affecting its physical and chemical behavior. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-4(2)5-6(7(10)11)9-3-8-5/h3-4H,1-2H3,(H,8,9)(H,10,11)
InChI key:InChIKey=OZFVPDUUZIEGAN-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(O)=O)N=CN1
Synonyms:- 4-(1-Methylethyl)-1H-imidazole-5-carboxylic acid
- 1H-Imidazole-4-carboxylic acid, 5-(1-methylethyl)-
- 1H-Imidazole-5-carboxylic acid, 4-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.