CAS 80304-44-5

4-Ethyl-1H-imidazole-5-carboxylic acid

Description:

4-Ethyl-1H-imidazole-5-carboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features an ethyl group at the 4-position and a carboxylic acid functional group at the 5-position of the imidazole ring, contributing to its acidic properties. The presence of the carboxylic acid group allows for potential hydrogen bonding and reactivity in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, the ethyl substituent can influence the compound's solubility and polarity, affecting its behavior in biological systems and potential applications. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or as a building block in organic synthesis. Its CAS number, 80304-44-5, provides a unique identifier for regulatory and safety information. Overall, 4-Ethyl-1H-imidazole-5-carboxylic acid exhibits properties typical of imidazole derivatives, including potential biological activity and versatility in chemical applications.

Formula: C₆H₈N₂O₂

InChI: InChI=1S/C6H8N2O2/c1-2-4-5(6(9)10)8-3-7-4/h3H,2H2,1H3,(H,7,8)(H,9,10)

InChI key: InChIKey=XOHKCCMVSAJWFL-UHFFFAOYSA-N

SMILES: C(C)C1=C(C(O)=O)N=CN1

Synonyms:

• 1H-Imidazole-4-carboxylic acid, 5-ethyl-
• 1H-Imidazole-5-carboxylic acid, 4-ethyl-
• 4-Ethyl-1H-imidazole-5-carboxylic acid