CAS 80304-46-7

[1-(1-methylethyl)-1H-imidazol-5-yl]methanol

Description:

[1-(1-methylethyl)-1H-imidazol-5-yl]methanol, with the CAS number 80304-46-7, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a side chain with an isopropyl group (1-methylethyl) attached to the imidazole ring, contributing to its unique properties. The presence of a hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit biological activity, potentially serving as a ligand or a precursor in various chemical syntheses. Its structural features suggest that it could interact with biological systems, making it of interest in medicinal chemistry. Additionally, the stability of the imidazole ring under various conditions allows for a range of applications in organic synthesis and pharmaceuticals. Overall, this compound's characteristics make it a subject of interest for further research in both chemical and biological contexts.

Formula: C₇H₁₂N₂O

InChI: InChI=1/C7H12N2O/c1-6(2)9-5-8-3-7(9)4-10/h3,5-6,10H,4H2,1-2H3

SMILES: CC(C)n1cncc1CO