CAS 80304-48-9
:(1-cyclohexyl-1H-imidazol-5-yl)methanol
Description:
(1-Cyclohexyl-1H-imidazol-5-yl)methanol, with the CAS number 80304-48-9, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a cyclohexyl group attached to the imidazole, contributing to its hydrophobic characteristics, while the methanol moiety provides a hydroxyl group that can participate in hydrogen bonding. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The compound is likely to exhibit properties typical of imidazole derivatives, such as potential biological activity, including antimicrobial or antifungal effects, due to the imidazole's role in various biochemical processes. Its structural features suggest that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C10H16N2O
InChI:InChI=1/C10H16N2O/c13-7-10-6-11-8-12(10)9-4-2-1-3-5-9/h6,8-9,13H,1-5,7H2
SMILES:C1CCC(CC1)n1cncc1CO
Synonyms:- 1H-Imidazole-5-methanol, 1-cyclohexyl-
- (1-cyclohexyl-1H-imidazol-5-yl)methanol(SALTDATA: FREE)
- CHEMBRDG-BB 4016576
- (1-CYCLOHEXYL-1H-IMIDAZOL-5-YL)METHANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.