CAS 80304-50-3
:1-Benzyl-5-hydroxymethyl-1H-imidazole
Description:
1-Benzyl-5-hydroxymethyl-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a benzyl group and a hydroxymethyl group contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the hydroxymethyl group, while the benzyl group may enhance its lipophilicity. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, owing to the functional groups present. The imidazole moiety is known for its biological significance, often acting as a building block in pharmaceuticals and biochemistry. Additionally, compounds with imidazole structures can exhibit diverse biological activities, including antimicrobial and antifungal properties. The specific characteristics, such as melting point, boiling point, and reactivity, can vary based on the compound's purity and the conditions under which it is studied. Overall, 1-Benzyl-5-hydroxymethyl-1H-imidazole represents a versatile structure with potential applications in medicinal chemistry and related fields.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c14-8-11-6-12-9-13(11)7-10-4-2-1-3-5-10/h1-6,9,14H,7-8H2
SMILES:c1ccc(cc1)Cn1cncc1CO
Synonyms:- 1H-Imidazole-5-methanol,1-(phenylmethyl)-
- (1-benzyl-1H-imidazol-5-yl)methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-Benzyl-5-hydroxymethyl-1H-imidazole
CAS:<p>1-Benzyl-5-hydroxymethyl-1H-imidazole is a dialkyl calcium channel antagonist that blocks the voltage-gated calcium channels in the nucleus and jejunum. It has been shown to have relaxant properties and antagonistic activity when it binds to the calcium channel. 1-Benzyl-5-hydroxymethyl-1H-imidazole has been investigated for its potential use as a treatment for disorders such as dyspepsia and peptic ulcer disease. The dimethylamino substituent on 1BHM may be responsible for its spontaneous decomposition, which limits its usefulness in vivo.</p>Formula:C11H12N2OPurity:Min. 95%Molecular weight:188.23 g/mol
