CAS 80308-80-1
:4-bromo-1-ethenyl-1H-pyrazole
Description:
4-Bromo-1-ethenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and an ethenyl group at the 1-position contributes to its unique reactivity and properties. This compound typically appears as a colorless to light yellow liquid or solid, depending on its purity and form. It is known for its potential applications in pharmaceuticals and agrochemicals, particularly as a building block in the synthesis of various biologically active molecules. The compound may exhibit moderate to high solubility in organic solvents, while its solubility in water is generally limited. Additionally, it may possess specific functional properties such as antimicrobial or herbicidal activity, making it of interest in research and development. As with many halogenated compounds, safety precautions should be taken when handling 4-bromo-1-ethenyl-1H-pyrazole due to potential toxicity and environmental impact.
Formula:C5H5BrN2
InChI:InChI=1/C5H5BrN2/c1-2-8-4-5(6)3-7-8/h2-4H,1H2
SMILES:C=Cn1cc(cn1)Br
Synonyms:- 1H-pyrazole, 4-bromo-1-ethenyl-
- 4-Bromo-1-vinyl-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Bromo-1-vinyl-1H-pyrazole
CAS:4-Bromo-1-vinyl-1H-pyrazole is a substituted pyrazole that has a molecular formula of C6H4BrN. It is a paramagnetic compound with two different rotational constants for the vinyl group. 4-Bromo-1-vinyl-1H-pyrazole has been shown to interact with ruthenium and titanium complexes, which is due to its ability to bind to the metal center by coordinate covalent bonding. This interaction leads to conformational changes in the molecules and can be rationalized as population constants or as quantum numbers. 4-Bromo-1-vinyl-1H-pyrazole also has an NMR spectrum that includes peaks at 0.9 ppm, 1.7 ppm, 2.3 ppm, and 3.2 ppm that correspond to various nuclei in the molecule such as protons and carbon isotopes.Formula:C5H5BrN2Purity:Min. 95%Molecular weight:173.01 g/mol

