
CAS 80349-58-2
:N-[[[1-(2-Naphthalenylmethyl)-4-piperidinyl]amino]carbonyl]benzamide
Description:
N-[[[1-(2-Naphthalenylmethyl)-4-piperidinyl]amino]carbonyl]benzamide, identified by its CAS number 80349-58-2, is a chemical compound characterized by its complex structure, which includes a naphthalene moiety, a piperidine ring, and an amide functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the naphthalene group may impart hydrophobic characteristics, while the piperidine ring can influence its interaction with biological targets, such as receptors or enzymes. The amide linkage suggests potential for hydrogen bonding, which can enhance solubility and stability in various environments. Compounds of this nature are often studied for their pharmacological properties, including potential applications in medicinal chemistry. However, specific characteristics such as solubility, melting point, and reactivity would require empirical data for precise determination. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic applications.
Formula:C24H25N3O2
InChI:InChI=1S/C24H25N3O2/c28-23(20-7-2-1-3-8-20)26-24(29)25-22-12-14-27(15-13-22)17-18-10-11-19-6-4-5-9-21(19)16-18/h1-11,16,22H,12-15,17H2,(H2,25,26,28,29)
InChI key:InChIKey=AQFFJGJVFJCQQL-UHFFFAOYSA-N
SMILES:C(C1=CC2=C(C=C1)C=CC=C2)N3CCC(NC(NC(=O)C4=CC=CC=C4)=O)CC3
Synonyms:- N-[[[1-(2-Naphthalenylmethyl)-4-piperidinyl]amino]carbonyl]benzamide
- Benzamide, N-[[[1-(2-naphthalenylmethyl)-4-piperidinyl]amino]carbonyl]-
- Panuramine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Panuramine
CAS:Panuramine is an antidepressant which was synthesized in 1981 by Wyeth. It acts as a potent and selective serotonin reuptake inhibitor (SSRI).Formula:C24H25N3O2Color and Shape:SolidMolecular weight:387.47
