CymitQuimica logo

CAS 80353-94-2

:

7-methylimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its aromatic properties. This compound contains a carboxylic acid functional group, which enhances its solubility in polar solvents and influences its reactivity. It is known for its potential biological activity, particularly in the context of mutagenicity and carcinogenicity, as it is a derivative of compounds formed during the cooking of certain meats at high temperatures. The presence of the methyl group at the 7-position of the imidazo ring is significant for its chemical behavior and biological interactions. This compound is typically studied in the fields of toxicology and food chemistry due to its implications in human health. Its molecular structure allows for various interactions with biological macromolecules, making it a subject of interest in research related to cancer risk assessment and the mechanisms of action of dietary carcinogens.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6/h2-5H,1H3,(H,12,13)
InChI key:GWOWWQVYWZHBRI-UHFFFAOYSA-N
SMILES:Cc1ccn2cc(C(=O)O)nc2c1
Synonyms:
  • Imidazo[1,2-A]Pyridine-2-Carboxylic Acid, 7-Methyl-
  • 7-Methylimidazo[1,2-a]pyridine-2-carboxylic acid
Found 4 products.