CAS 80353-97-5

7-Methoxy-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid

Description:

7-Methoxy-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid, with the CAS number 80353-97-5, is a heterocyclic compound characterized by its imidazo-pyrimidine structure. This compound features a methoxy group and a methyl group, contributing to its unique chemical properties. It is typically classified as a carboxylic acid due to the presence of a carboxyl functional group (-COOH), which imparts acidic characteristics. The presence of nitrogen atoms in the imidazo and pyrimidine rings enhances its potential for biological activity, making it of interest in pharmaceutical research. The compound may exhibit solubility in polar solvents, influenced by the functional groups present. Its structural features suggest potential interactions with biological systems, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 7-Methoxy-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid represents a complex chemical entity with potential implications in medicinal chemistry and related fields.

Formula: C₉H₉N₃O₃

InChI: InChI=1S/C9H9N3O3/c1-5-10-8(15-2)3-7-11-6(9(13)14)4-12(5)7/h3-4H,1-2H3,(H,13,14)

InChI key: InChIKey=BPKQNNWLGFUHKQ-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(C(O)=O)=C2)C=C(OC)N1

Synonyms:

• Imidazo[1,2-c]pyrimidine-2-carboxylic acid, 7-methoxy-5-methyl-
• 7-Methoxy-5-methylimidazo[1,2-c]pyrimidine-2-carboxylic acid