CAS 80357-74-0
:4-(1,3-benzothiazol-2-ylsulfanyl)butanoic acid
Description:
4-(1,3-benzothiazol-2-ylsulfanyl)butanoic acid is an organic compound characterized by its unique structure, which includes a butanoic acid moiety linked to a benzothiazole group via a sulfanyl (thioether) connection. This compound typically exhibits properties associated with both the carboxylic acid functional group and the heterocyclic benzothiazole ring. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. The benzothiazole component may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the presence of sulfur in the structure can influence its reactivity and interaction with other chemical species. The compound may also exhibit potential applications in various fields, including medicinal chemistry and materials science, due to its unique structural features. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.
Formula:C11H11NO2S2
InChI:InChI=1/C11H11NO2S2/c13-10(14)6-3-7-15-11-12-8-4-1-2-5-9(8)16-11/h1-2,4-5H,3,6-7H2,(H,13,14)
SMILES:c1ccc2c(c1)nc(SCCCC(=O)O)s2
Synonyms:- 4-(Benzothiazol-2-ylsulfanyl)-butyric acid
- Butanoic acid, 4-(2-benzothiazolylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
