CAS 80358-06-1
:6-acetyl-5-hydroxy-4-methoxy-7-methylnaphthalen-2-yl beta-D-glucopyranoside
Description:
6-Acetyl-5-hydroxy-4-methoxy-7-methylnaphthalen-2-yl beta-D-glucopyranoside, with the CAS number 80358-06-1, is a glycoside compound derived from naphthalene. This substance features a naphthalene ring substituted with various functional groups, including an acetyl group, a hydroxy group, and a methoxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the beta-D-glucopyranoside moiety indicates that it is a sugar derivative, which may enhance its solubility in water and influence its interaction with biological systems. This compound may exhibit antioxidant properties and could be of interest in pharmacological research, particularly in the context of natural products and their derivatives. Its structural complexity suggests potential applications in medicinal chemistry, where modifications to the naphthalene core could lead to novel therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as pH and temperature.
Formula:C20H24O9
InChI:InChI=1/C20H24O9/c1-8-4-10-5-11(6-12(27-3)15(10)17(24)14(8)9(2)22)28-20-19(26)18(25)16(23)13(7-21)29-20/h4-6,13,16,18-21,23-26H,7H2,1-3H3/t13-,16-,18+,19-,20-/m1/s1
Synonyms:- Ethanone, 1-(6-(beta-D-glucopyranosyloxy)-1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl)-
- Ethanone, 1-[6-(β-D-glucopyranosyloxy)-1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl]-
- 1-[6-(beta-D-Glucopyranosyloxy)-1-hydroxy-8-methoxy-3-methyl-2-naphthalenyl]ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Tinnevellin glucoside
CAS:Tinnevellin glucoside is a natural product from Cassia angustifolia.Formula:C20H24O9Purity:98.45%Color and Shape:SolidMolecular weight:408.40Tinnevellin glucoside
CAS:Natural glycosideFormula:C20H24O9Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:408.4Tinnevellin glucoside
CAS:Tinnevellin glucoside is a natural glycoside, which is derived from the leaves of certain plant species, particularly those belonging to the Tinnevelly senna. This compound is well-characterized by its anti-inflammatory and antioxidant properties. It acts primarily through modulating key inflammatory pathways, thus reducing the production of pro-inflammatory cytokines and reactive oxygen species, which are involved in the inflammatory process.Purity:Min. 95%






