CymitQuimica logo

CAS 803603-49-8

:

2-(5-(pyridin-3-yl)-1,3,4-oxadiazol-2-yl)ethanamine

Description:
2-(5-(Pyridin-3-yl)-1,3,4-oxadiazol-2-yl)ethanamine, with the CAS number 803603-49-8, is a chemical compound characterized by its unique structure that includes a pyridine ring and an oxadiazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents, which is influenced by the presence of both the amine and heterocyclic groups. The oxadiazole ring contributes to its potential biological activity, often associated with antimicrobial or anti-inflammatory properties. The pyridine component may enhance its interaction with biological targets due to its nitrogen atom, which can participate in hydrogen bonding. Additionally, the compound may display interesting electronic properties due to the conjugation between the aromatic systems and the oxadiazole, potentially making it a candidate for various applications in medicinal chemistry or materials science. Its stability and reactivity can be influenced by the functional groups present, making it a subject of interest for further research in drug development and synthesis.
Formula:C8H8N4O
InChI:InChI=1/C8H8N4O/c9-5-7-11-12-8(13-7)6-1-3-10-4-2-6/h1-4H,5,9H2
Synonyms:
  • 5-(4-pyridinyl)-1,3,4-Oxadiazole-2-methanamine
  • (5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl)methanamine
  • 1,3,4-Oxadiazole-2-methanamine, 5-(4-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.