CAS 80364-71-2

2-chloro-N-(2,3-dimethoxybenzyl)acetamide

Description:

2-Chloro-N-(2,3-dimethoxybenzyl)acetamide is an organic compound characterized by its acetamide functional group, which is substituted with a chloro group and a dimethoxybenzyl moiety. The presence of the chloro substituent introduces a degree of polarity and can influence the compound's reactivity and solubility. The dimethoxybenzyl group, consisting of a benzene ring with two methoxy (-OCH3) groups at the 2 and 3 positions, contributes to the compound's overall hydrophobic character and can affect its biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for various applications in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (chloro) groups can influence the electronic properties of the molecule, impacting its reactivity and interaction with other chemical species. Overall, 2-chloro-N-(2,3-dimethoxybenzyl)acetamide is a compound of interest in the field of organic and medicinal chemistry.

Formula: C₁₁H₁₄ClNO₃

InChI: InChI=1/C11H14ClNO3/c1-15-9-5-3-4-8(11(9)16-2)7-13-10(14)6-12/h3-5H,6-7H2,1-2H3,(H,13,14)

SMILES: COc1cccc(CN=C(CCl)O)c1OC