CAS 80364-88-1

2-chloro-N-(3,4-dimethoxybenzyl)propanamide

Description:

2-chloro-N-(3,4-dimethoxybenzyl)propanamide is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the second position of the carbon chain contributes to its reactivity and potential biological activity. The compound features a benzyl group that is substituted with two methoxy groups at the 3 and 4 positions, enhancing its lipophilicity and possibly influencing its interaction with biological targets. This structural arrangement may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic components. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it may be used in research related to drug development or as a chemical intermediate. Safety data should be consulted for handling, as the presence of chlorine and other functional groups may pose health risks.

Formula: C₁₂H₁₆ClNO₃

InChI: InChI=1/C12H16ClNO3/c1-8(13)12(15)14-7-9-4-5-10(16-2)11(6-9)17-3/h4-6,8H,7H2,1-3H3,(H,14,15)

SMILES: CC(C(=NCc1ccc(c(c1)OC)OC)O)Cl

2-Chloro-N-[(3,4-dimethoxyphenyl)methyl]propanamide

CAS: 80364-88-1

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO₃

Purity: Min. 95%

Molecular weight: 257.71 g/mol

Ref: 3D-FDA36488